![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| chord﹪20length﹪252Fsurface﹪20area.txt | 2022-12-19 16:45 | 7.0K | |
| XybionCamMacros.txt | 2022-12-19 16:45 | 5.7K | |
| Image_errors_notes.txt | 2022-12-19 16:45 | 2.4K | |
| readme.sunraster.txt | 2022-12-19 16:45 | 253 | |
| read.GESIGNA.txt | 2022-12-19 16:45 | 15K | |
| testClusterMap | 2022-12-19 16:46 | 4.3K | |
| Gel_Plottting_Macro_Andreas.txt | 2022-12-19 16:46 | 8.4K | |
| SelectTool()_macros.txt | 2022-12-19 16:46 | 2.2K | |
| imageaev.sea | 2022-12-19 16:46 | 371K | |
| Surface of Fe3O4 | 2022-12-19 16:46 | 143K | |
| area | 2022-12-19 16:46 | 497 | |
| SaveRestore_Data macro.txt | 2022-12-19 16:46 | 3.1K | |
| Annular selection from line | 2022-12-19 16:46 | 955 | |
| nih-imag.txt | 2022-12-19 16:46 | 1.0K | |
| mriconverter.sit | 2022-12-19 16:47 | 66K | |
| Spaces to TAB.txt | 2022-12-19 16:47 | 0 | |
| Centroid.txt | 2022-12-19 16:47 | 874 | |
| Gel MW Macro.txt | 2022-12-19 16:47 | 3.8K | |
| SnakesApp.txt | 2022-12-19 16:47 | 1.6K | |
| NIH_Image_158_Doc_PC.txt | 2022-12-19 16:47 | 502 | |
| Sunraster.reader | 2022-12-19 16:47 | 6.8K | |
| Image1.55Xybion.txt | 2022-12-19 16:48 | 0 | |
| ChordLength.SurfaceArea.txt | 2022-12-19 16:48 | 7.0K | |
| EHelpEngine﹪AA﹪204.0n.txt | 2022-12-19 16:48 | 0 | |
| UPC-A Barcode (12chars).txt | 2022-12-19 16:48 | 4.5K | |
| MW-Macro for 1 & 2D gels.txt | 2022-12-19 16:48 | 32K | |
| readme.txt | 2022-12-19 16:48 | 448 | |
| testClusterMapLabels | 2022-12-19 16:48 | 6.8K | |
| NIH_Image_158_Doc_PC.zip | 2022-12-19 16:48 | 209K | |
| nih_imag.txt | 2022-12-19 16:55 | 502 | |
| StackSplicers | 2022-12-19 16:55 | 2.4K | |
| Kinematics_macros.txt | 2022-12-19 16:55 | 6.5K | |
| EFA.sit | 2022-12-19 16:55 | 32K | |
| signamacros.txt | 2022-12-19 16:55 | 17K | |
| EFMT MRT Analysis.sea | 2022-12-19 16:55 | 480K | |
| SmallOctoRoo.tiff | 2022-12-19 16:55 | 922K | |
| PresentationImage/ | 2023-10-27 12:31 | - | |
| MultipleROI-source.1.sea/ | 2023-10-27 12:31 | - | |
| Spatial Patterns 2.3.2/ | 2023-10-27 12:31 | - | |
| MultipleROI-program.1.sea/ | 2023-10-27 12:31 | - | |
| ƒ AutoMatch 3.1.0b/ | 2023-10-27 12:31 | - | |
| med-volviz-faq/ | 2023-10-27 12:31 | - | |
| ImageAEv0.5 Source/ | 2023-10-27 12:31 | - | |
| ColorImage159/ | 2023-10-27 12:31 | - | |
| ImageAEv0.5/ | 2023-10-27 12:31 | - | |
| Image 1.61Hull68k/ | 2023-10-27 12:31 | - | |
| Cavalieri_3/ | 2023-10-27 12:31 | - | |
| NIH-Image_159_Hough_ppc.1.sea/ | 2023-10-27 12:31 | - | |
| SnakesApp.1.sea/ | 2023-10-27 12:31 | - | |
| Archive.1.sea/ | 2023-10-27 12:31 | - | |
| Image_error_tests/ | 2023-10-27 12:31 | - | |
| FileNotes Folder/ | 2023-10-27 12:31 | - | |
| index.html | 2023-10-27 13:38 | 12K | |
| Reconstruction/ | 2023-10-27 13:38 | - | |